Dehydroepiandrosterone

Dehydroisoepiandrosterone | Watchedfields = changed | verifiedrevid = 443682301

| Section1 = | CASNo = 53-43-0 | ChEBI_Ref = | ChEBI = 28689 | ChEMBL_Ref = | ChEMBL = 90593 | ChemSpiderID_Ref = | ChemSpiderID = 5670 | DrugBank_Ref = | DrugBank = DB01708 | PubChem = 5881 | StdInChI_Ref = | StdInChI = 1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h3,13-16,20H,4-11H2,1-2H3/t13-,14-,15-,16-,18-,19-/m0/s1 | StdInChIKey_Ref = | StdInChIKey = FMGSKLZLMKYGDP-USOAJAOKSA-N | SMILES = O=C3[C@]2(CC[C@@H]1[C@@]4(C(=C/C[C@H]1[C@@H]2CC3)\C[C@@H](O)CC4)C)C | UNII_Ref = | UNII = 459AG36T1B }} | Section2 = | Section3 = | Section6 = (combination with estrogen) | AdminRoutes = By mouth, vaginal (insert), intramuscular injection (as prasterone enanthate), injection (as prasterone sodium sulfate) | Bioavail = 50% | Excretion = Urine | HalfLife = : 25 minutes
: 11 hours | Metabolism = Hepatic | ProteinBound = }} }}

Dehydroepiandrosterone (DHEA), also known as androstenolone, is an endogenous steroid hormone precursor. It is one of the most abundant circulating steroids in humans. DHEA is produced in the adrenal glands, the gonads, and the brain. It functions as a metabolic intermediate in the biosynthesis of the androgen and estrogen sex steroids both in the gonads and in various other tissues. However, DHEA also has a variety of potential biological effects in its own right, binding to an array of nuclear and cell surface receptors, and acting as a neurosteroid and modulator of neurotrophic factor receptors.

In the United States, DHEA is sold as an over-the-counter supplement, and medication called prasterone.

Provided by Wikipedia